C12H17ClN2 — CID 115728805
N-[2-(6-chloro-3-pyridinyl)ethyl]-1-cyclopropylethanamine (PubChem CID 115728805) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is N-[2-(6-chloro-3-pyridinyl)ethyl]-1-cyclopropylethanamine.
| Compound Name | N-[2-(6-chloro-3-pyridinyl)ethyl]-1-cyclopropylethanamine |
|---|---|
| PubChem CID | 115728805 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[2-(6-chloro-3-pyridinyl)ethyl]-1-cyclopropylethanamine |
| SMILES | CC(NCCc1ccc(Cl)nc1)C1CC1 |
| InChI | InChI=1S/C12H17ClN2/c1-9(11-3-4-11)14-7-6-10-2-5-12(13)15-8-10/h2,5,8-9,11,14H,3-4,6-7H2,1H3 |
| InChIKey | RVRFRYJHHSPVMO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|