C14H19N3O4 — CID 115730289
6-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 115730289) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115730289 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 6-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | CC(NC(=O)c1cccc(C(=O)O)n1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H19N3O4/c1-8(11(18)17-14(2,3)4)15-12(19)9-6-5-7-10(16-9)13(20)21/h5-8H,1-4H3,(H,15,19)(H,17,18)(H,20,21) |
| InChIKey | MLSATRYXHZAHNJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |