2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid

C10H17NO3 — CID 115731134

IUPAC2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid
SMILESCC(NC(=O)/C=C/C(C)(C)C)C(=O)O
InChIInChI=1S/C10H17NO3/c1-7(9(13)14)11-8(12)5-6-10(2,3)4/h5-7H,1-4H3,(H,11,12)(H,13,14)/b6-5+
InChIKeyVLXQIFAXXYXZGV-AATRIKPKSA-N
MW199.25 g/mol
LogP1.18
Rot. Bonds3

About 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid

2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid (PubChem CID 115731134) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid.

Molecular Properties

Compound Name2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid
PubChem CID115731134
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Name2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid
SMILESCC(NC(=O)/C=C/C(C)(C)C)C(=O)O
InChIInChI=1S/C10H17NO3/c1-7(9(13)14)11-8(12)5-6-10(2,3)4/h5-7H,1-4H3,(H,11,12)(H,13,14)/b6-5+
InChIKeyVLXQIFAXXYXZGV-AATRIKPKSA-N
XLogP1.18
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid?
The IUPAC name of 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid (CID 115731134) is 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid.
What is the SMILES notation for 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid?
The canonical SMILES for 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid is CC(NC(=O)/C=C/C(C)(C)C)C(=O)O.
What is the InChIKey of 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid?
The InChIKey is VLXQIFAXXYXZGV-AATRIKPKSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7(9(13)14)11-8(12)5-6-10(2,3)4/h5-7H,1-4H3,(H,11,12)(H,13,14)/b6-5+.
What are the key properties of 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid?
2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid has a molecular weight of 199.25 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-4,4-dimethylpent-2-enoyl]amino]propanoic acid is sourced from PubChem (CID 115731134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).