C6H9NO3 — CID 139775909
(2S)-2-(3-deuterioprop-2-enoylamino)propanoic acid (PubChem CID 139775909) has the molecular formula C6H9NO3 and a molecular weight of 144.15 g/mol. Its IUPAC name is (2S)-2-(3-deuterioprop-2-enoylamino)propanoic acid.
| Compound Name | (2S)-2-(3-deuterioprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 139775909 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (2S)-2-(3-deuterioprop-2-enoylamino)propanoic acid |
| SMILES | [2H]/C=C/C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C6H9NO3/c1-3-5(8)7-4(2)6(9)10/h3-4H,1H2,2H3,(H,7,8)(H,9,10)/t4-/m0/s1/i1D/b3-1+ |
| InChIKey | PPRBGMXQDAMDAB-PSMXKPCISA-N |
| XLogP | -0.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|