C13H16N2O3S — CID 115732274
2,6-dimethoxy-4-[(1,3-thiazol-5-ylmethylamino)methyl]phenol (PubChem CID 115732274) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(1,3-thiazol-5-ylmethylamino)methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(1,3-thiazol-5-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 115732274 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2,6-dimethoxy-4-[(1,3-thiazol-5-ylmethylamino)methyl]phenol |
| SMILES | COc1cc(CNCc2cncs2)cc(OC)c1O |
| InChI | InChI=1S/C13H16N2O3S/c1-17-11-3-9(4-12(18-2)13(11)16)5-14-6-10-7-15-8-19-10/h3-4,7-8,14,16H,5-6H2,1-2H3 |
| InChIKey | KLICMVGVTWDFDW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |