C10H18FN3S — CID 115732929
5-[(3-fluoropropylamino)methyl]-N,N,4-trimethyl-1,3-thiazol-2-amine (PubChem CID 115732929) has the molecular formula C10H18FN3S and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-[(3-fluoropropylamino)methyl]-N,N,4-trimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(3-fluoropropylamino)methyl]-N,N,4-trimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115732929 |
| Molecular Formula | C10H18FN3S |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 5-[(3-fluoropropylamino)methyl]-N,N,4-trimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N(C)C)sc1CNCCCF |
| InChI | InChI=1S/C10H18FN3S/c1-8-9(7-12-6-4-5-11)15-10(13-8)14(2)3/h12H,4-7H2,1-3H3 |
| InChIKey | KDZMVJXNPPCGFS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|