C17H27N3O3 — CID 11573328
2-(dimethylamino)ethyl 4-(4-acetamidobutylamino)benzoate (PubChem CID 11573328) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-(4-acetamidobutylamino)benzoate.
| Compound Name | 2-(dimethylamino)ethyl 4-(4-acetamidobutylamino)benzoate |
|---|---|
| PubChem CID | 11573328 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-(4-acetamidobutylamino)benzoate |
| SMILES | CC(=O)NCCCCNc1ccc(C(=O)OCCN(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O3/c1-14(21)18-10-4-5-11-19-16-8-6-15(7-9-16)17(22)23-13-12-20(2)3/h6-9,19H,4-5,10-13H2,1-3H3,(H,18,21) |
| InChIKey | IOQXZHQOQKKKFA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|