C13H26N4O3 — CID 115738482
3-[[2-(4-aminopiperidin-1-yl)acetyl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 115738482) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-[[2-(4-aminopiperidin-1-yl)acetyl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[2-(4-aminopiperidin-1-yl)acetyl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 115738482 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-[[2-(4-aminopiperidin-1-yl)acetyl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNC(=O)CN1CCC(N)CC1 |
| InChI | InChI=1S/C13H26N4O3/c1-20-9-6-16-12(18)2-5-15-13(19)10-17-7-3-11(14)4-8-17/h11H,2-10,14H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | FWHXGHCSEGFFLV-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|