C16H29N3O3 — CID 51072787
N-(2-methoxyethyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetamide (PubChem CID 51072787) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51072787 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetamide |
| SMILES | COCCNC(=O)CN1CCC(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C16H29N3O3/c1-22-12-7-17-15(20)13-18-10-5-14(6-11-18)16(21)19-8-3-2-4-9-19/h14H,2-13H2,1H3,(H,17,20) |
| InChIKey | XPHBIJXHLIIXBC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|