C17H31N3O6 — CID 171700198
N-(2-methoxyethyl)-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid (PubChem CID 171700198) has the molecular formula C17H31N3O6 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid.
| Compound Name | N-(2-methoxyethyl)-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 171700198 |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-(2-methoxyethyl)-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid |
| SMILES | COCCNC(=O)CN1CCC(N2CCCCC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H29N3O2.C2H2O4/c1-20-12-7-16-15(19)13-17-10-5-14(6-11-17)18-8-3-2-4-9-18;3-1(4)2(5)6/h14H,2-13H2,1H3,(H,16,19);(H,3,4)(H,5,6) |
| InChIKey | VDFFGZOUDMJLJX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|