About [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1)
[1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1) (PubChem CID 70199542) has the molecular formula C12H22KN2O2
and a molecular weight of 265.42 g/mol.
Analyze [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1)?
The IUPAC name of [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1) (CID 70199542) is not available.
What is the SMILES notation for [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1)?
The canonical SMILES for [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1) is O=C(O)CN1CCC(N2CCCCC2)CC1.[K].
What is the InChIKey of [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1)?
The InChIKey is CNWPEAWMGCFKQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2.K/c15-12(16)10-13-8-4-11(5-9-13)14-6-2-1-3-7-14;/h11H,1-10H2,(H,15,16);.
What are the key properties of [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1)?
[1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1) has a molecular weight of 265.42 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4'-Bipiperidine]-1'-aceticacid,potassiumsalt(1:1) is sourced from PubChem (CID 70199542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).