C17H30N4O3 — CID 139720169
2-[4-[4-(piperidine-4-carbonyl)piperazin-1-yl]piperidin-1-yl]acetic acid (PubChem CID 139720169) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[4-[4-(piperidine-4-carbonyl)piperazin-1-yl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(piperidine-4-carbonyl)piperazin-1-yl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 139720169 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 2-[4-[4-(piperidine-4-carbonyl)piperazin-1-yl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(N2CCN(C(=O)C3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C17H30N4O3/c22-16(23)13-19-7-3-15(4-8-19)20-9-11-21(12-10-20)17(24)14-1-5-18-6-2-14/h14-15,18H,1-13H2,(H,22,23) |
| InChIKey | JYSGOMURPFOBPM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |