C14H28Cl2N4O3 — CID 119836395
N-(2-methoxyethyl)-2-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]acetamide;dihydrochloride (PubChem CID 119836395) has the molecular formula C14H28Cl2N4O3 and a molecular weight of 371.31 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-(2-methoxyethyl)-2-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119836395 |
| Molecular Formula | C14H28Cl2N4O3 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]acetamide;dihydrochloride |
| SMILES | COCCNC(=O)CN1CCN(C(=O)C2CCCN2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H26N4O3.2ClH/c1-21-10-5-16-13(19)11-17-6-8-18(9-7-17)14(20)12-3-2-4-15-12;;/h12,15H,2-11H2,1H3,(H,16,19);2*1H |
| InChIKey | PNKMBYZKXLNAGS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|