C15H28Cl2N4O2 — CID 119837819
2-[4-[(2R)-piperidine-2-carbonyl]piperazin-1-yl]-N-prop-2-enylacetamide;dihydrochloride (PubChem CID 119837819) has the molecular formula C15H28Cl2N4O2 and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-[4-[(2R)-piperidine-2-carbonyl]piperazin-1-yl]-N-prop-2-enylacetamide;dihydrochloride.
| Compound Name | 2-[4-[(2R)-piperidine-2-carbonyl]piperazin-1-yl]-N-prop-2-enylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119837819 |
| Molecular Formula | C15H28Cl2N4O2 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[4-[(2R)-piperidine-2-carbonyl]piperazin-1-yl]-N-prop-2-enylacetamide;dihydrochloride |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)[C@H]2CCCCN2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H26N4O2.2ClH/c1-2-6-17-14(20)12-18-8-10-19(11-9-18)15(21)13-5-3-4-7-16-13;;/h2,13,16H,1,3-12H2,(H,17,20);2*1H/t13-;;/m1../s1 |
| InChIKey | NWFSULXGHLXPHM-FFXKMJQXSA-N |
| XLogP | 0.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|