C15H26N4O2 — CID 60940035
2-[4-(piperidine-2-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 60940035) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[4-(piperidine-2-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(piperidine-2-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 60940035 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-[4-(piperidine-2-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)C2CCCCN2)CC1 |
| InChI | InChI=1S/C15H26N4O2/c1-2-6-17-14(20)12-18-8-10-19(11-9-18)15(21)13-5-3-4-7-16-13/h2,13,16H,1,3-12H2,(H,17,20) |
| InChIKey | HHCCGKCINFEXQX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|