C15H30Cl2N4O4 — CID 120797311
2-[4-[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;dihydrochloride (PubChem CID 120797311) has the molecular formula C15H30Cl2N4O4 and a molecular weight of 401.34 g/mol. Its IUPAC name is 2-[4-[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;dihydrochloride.
| Compound Name | 2-[4-[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120797311 |
| Molecular Formula | C15H30Cl2N4O4 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[4-[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;dihydrochloride |
| SMILES | COCCNC(=O)CN1CCN(C(=O)[C@@H]2CC[C@H](CN)O2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H28N4O4.2ClH/c1-22-9-4-17-14(20)11-18-5-7-19(8-6-18)15(21)13-3-2-12(10-16)23-13;;/h12-13H,2-11,16H2,1H3,(H,17,20);2*1H/t12-,13+;;/m1../s1 |
| InChIKey | GXPODMAWUYGAQZ-VAALMUBNSA-N |
| XLogP | -0.76 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|