C12H22F2N2O — CID 115738604
N-(2,2-difluoroethyl)-N-methyl-3-piperidin-3-ylbutanamide (PubChem CID 115738604) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-methyl-3-piperidin-3-ylbutanamide.
| Compound Name | N-(2,2-difluoroethyl)-N-methyl-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 115738604 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-methyl-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)N(C)CC(F)F)C1CCCNC1 |
| InChI | InChI=1S/C12H22F2N2O/c1-9(10-4-3-5-15-7-10)6-12(17)16(2)8-11(13)14/h9-11,15H,3-8H2,1-2H3 |
| InChIKey | BKZJLCHXRWHSRR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |