3-piperidin-3-ylbutanoic acid

C9H17NO2 — CID 71691534

IUPAC3-piperidin-3-ylbutanoic acid
SMILESCC(CC(=O)O)C1CCCNC1
InChIInChI=1S/C9H17NO2/c1-7(5-9(11)12)8-3-2-4-10-6-8/h7-8,10H,2-6H2,1H3,(H,11,12)
InChIKeyDXUVFXUATDRNTO-UHFFFAOYSA-N
MW171.24 g/mol
LogP1.10
Rot. Bonds3

About 3-piperidin-3-ylbutanoic acid

3-piperidin-3-ylbutanoic acid (PubChem CID 71691534) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-piperidin-3-ylbutanoic acid.

Molecular Properties

Compound Name3-piperidin-3-ylbutanoic acid
PubChem CID71691534
Molecular FormulaC9H17NO2
Molecular Weight171.24 g/mol
Exact Mass171.13
IUPAC Name3-piperidin-3-ylbutanoic acid
SMILESCC(CC(=O)O)C1CCCNC1
InChIInChI=1S/C9H17NO2/c1-7(5-9(11)12)8-3-2-4-10-6-8/h7-8,10H,2-6H2,1H3,(H,11,12)
InChIKeyDXUVFXUATDRNTO-UHFFFAOYSA-N
XLogP1.10
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.24
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-piperidin-3-ylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-piperidin-3-ylbutanoic acid?
The IUPAC name of 3-piperidin-3-ylbutanoic acid (CID 71691534) is 3-piperidin-3-ylbutanoic acid.
What is the SMILES notation for 3-piperidin-3-ylbutanoic acid?
The canonical SMILES for 3-piperidin-3-ylbutanoic acid is CC(CC(=O)O)C1CCCNC1.
What is the InChIKey of 3-piperidin-3-ylbutanoic acid?
The InChIKey is DXUVFXUATDRNTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-7(5-9(11)12)8-3-2-4-10-6-8/h7-8,10H,2-6H2,1H3,(H,11,12).
What are the key properties of 3-piperidin-3-ylbutanoic acid?
3-piperidin-3-ylbutanoic acid has a molecular weight of 171.24 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-3-ylbutanoic acid is sourced from PubChem (CID 71691534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).