C13H24N2O4 — CID 107824927
(2S)-4-hydroxy-2-(3-piperidin-3-ylbutanoylamino)butanoic acid (PubChem CID 107824927) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(3-piperidin-3-ylbutanoylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(3-piperidin-3-ylbutanoylamino)butanoic acid |
|---|---|
| PubChem CID | 107824927 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (2S)-4-hydroxy-2-(3-piperidin-3-ylbutanoylamino)butanoic acid |
| SMILES | CC(CC(=O)N[C@@H](CCO)C(=O)O)C1CCCNC1 |
| InChI | InChI=1S/C13H24N2O4/c1-9(10-3-2-5-14-8-10)7-12(17)15-11(4-6-16)13(18)19/h9-11,14,16H,2-8H2,1H3,(H,15,17)(H,18,19)/t9?,10?,11-/m0/s1 |
| InChIKey | XLXLDVAYJKUCDO-ILDUYXDCSA-N |
| XLogP | -0.04 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |