C14H28N2O3 — CID 81043605
N-(1,1-dimethoxypropan-2-yl)-3-piperidin-3-ylbutanamide (PubChem CID 81043605) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 81043605 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-3-piperidin-3-ylbutanamide |
| SMILES | COC(OC)C(C)NC(=O)CC(C)C1CCCNC1 |
| InChI | InChI=1S/C14H28N2O3/c1-10(12-6-5-7-15-9-12)8-13(17)16-11(2)14(18-3)19-4/h10-12,14-15H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | TVMABNUKDXMTNR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|