C15H25N3OS — CID 115739845
N-(2-methyl-2-methylsulfanylpropyl)-1-piperidin-4-ylpyrrole-2-carboxamide (PubChem CID 115739845) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-(2-methyl-2-methylsulfanylpropyl)-1-piperidin-4-ylpyrrole-2-carboxamide.
| Compound Name | N-(2-methyl-2-methylsulfanylpropyl)-1-piperidin-4-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115739845 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(2-methyl-2-methylsulfanylpropyl)-1-piperidin-4-ylpyrrole-2-carboxamide |
| SMILES | CSC(C)(C)CNC(=O)c1cccn1C1CCNCC1 |
| InChI | InChI=1S/C15H25N3OS/c1-15(2,20-3)11-17-14(19)13-5-4-10-18(13)12-6-8-16-9-7-12/h4-5,10,12,16H,6-9,11H2,1-3H3,(H,17,19) |
| InChIKey | YHORZABVYWATMZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |