C17H29N3O — CID 81494193
1-piperidin-4-yl-N-(2,3,3-trimethylbutyl)pyrrole-2-carboxamide (PubChem CID 81494193) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(2,3,3-trimethylbutyl)pyrrole-2-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-(2,3,3-trimethylbutyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 81494193 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-piperidin-4-yl-N-(2,3,3-trimethylbutyl)pyrrole-2-carboxamide |
| SMILES | CC(CNC(=O)c1cccn1C1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C17H29N3O/c1-13(17(2,3)4)12-19-16(21)15-6-5-11-20(15)14-7-9-18-10-8-14/h5-6,11,13-14,18H,7-10,12H2,1-4H3,(H,19,21) |
| InChIKey | FGFBVHRSBUBPHW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |