C14H25N5OS — CID 115740009
N-(4-ethylsulfanylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 115740009) has the molecular formula C14H25N5OS and a molecular weight of 311.46 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 115740009 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CCSCCC(C)NC(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H25N5OS/c1-3-21-9-6-11(2)16-14(20)13-10-19(18-17-13)12-4-7-15-8-5-12/h10-12,15H,3-9H2,1-2H3,(H,16,20) |
| InChIKey | JXQWMAIAPKXCJA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|