C12H24N2O — CID 115741760
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 115741760) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 115741760 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCC1=CCCOC1 |
| InChI | InChI=1S/C12H24N2O/c1-3-14(4-2)8-7-13-10-12-6-5-9-15-11-12/h6,13H,3-5,7-11H2,1-2H3 |
| InChIKey | DAPZPUDBOOXPFJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|