C11H20N2O2 — CID 115741784
2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylacetamide (PubChem CID 115741784) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylacetamide.
| Compound Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylacetamide |
|---|---|
| PubChem CID | 115741784 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylacetamide |
| SMILES | CCCNC(=O)CNCC1=CCCOC1 |
| InChI | InChI=1S/C11H20N2O2/c1-2-5-13-11(14)8-12-7-10-4-3-6-15-9-10/h4,12H,2-3,5-9H2,1H3,(H,13,14) |
| InChIKey | DEXSTAMWLCNMNT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|