C12H21NO2 — CID 115741911
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-(oxan-2-yl)methanamine (PubChem CID 115741911) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-(oxan-2-yl)methanamine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 115741911 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-(oxan-2-yl)methanamine |
| SMILES | C1=C(CNCC2CCCCO2)COCC1 |
| InChI | InChI=1S/C12H21NO2/c1-2-7-15-12(5-1)9-13-8-11-4-3-6-14-10-11/h4,12-13H,1-3,5-10H2 |
| InChIKey | UVPWREALDQYFPQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|