C12H25NO — CID 177009350
(2S,3S)-N,4-diethyl-2-methyl-3,6-dihydro-2H-pyran-3-amine;ethane (PubChem CID 177009350) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (2S,3S)-N,4-diethyl-2-methyl-3,6-dihydro-2H-pyran-3-amine;ethane.
| Compound Name | (2S,3S)-N,4-diethyl-2-methyl-3,6-dihydro-2H-pyran-3-amine;ethane |
|---|---|
| PubChem CID | 177009350 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (2S,3S)-N,4-diethyl-2-methyl-3,6-dihydro-2H-pyran-3-amine;ethane |
| SMILES | CC.CCN[C@H]1C(CC)=CCO[C@H]1C |
| InChI | InChI=1S/C10H19NO.C2H6/c1-4-9-6-7-12-8(3)10(9)11-5-2;1-2/h6,8,10-11H,4-5,7H2,1-3H3;1-2H3/t8-,10+;/m0./s1 |
| InChIKey | RGLVKODMKUGOCV-KXNXZCPBSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|