C12H22N2O2 — CID 115741926
4-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,N-dimethylbutanamide (PubChem CID 115741926) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,N-dimethylbutanamide.
| Compound Name | 4-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 115741926 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCNCC1=CCCOC1 |
| InChI | InChI=1S/C12H22N2O2/c1-14(2)12(15)6-3-7-13-9-11-5-4-8-16-10-11/h5,13H,3-4,6-10H2,1-2H3 |
| InChIKey | XLMQZNHZKQRRIV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|