C9H14BrNO — CID 115741993
2-bromo-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine (PubChem CID 115741993) has the molecular formula C9H14BrNO and a molecular weight of 232.12 g/mol. Its IUPAC name is 2-bromo-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine.
| Compound Name | 2-bromo-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 115741993 |
| Molecular Formula | C9H14BrNO |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-bromo-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine |
| SMILES | C=C(Br)CNCC1=CCCOC1 |
| InChI | InChI=1S/C9H14BrNO/c1-8(10)5-11-6-9-3-2-4-12-7-9/h3,11H,1-2,4-7H2 |
| InChIKey | GLKGGYQJIBLTMW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|