C9H14ClNO — CID 115742132
2-chloro-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine (PubChem CID 115742132) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is 2-chloro-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine.
| Compound Name | 2-chloro-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 115742132 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-chloro-N-(3,6-dihydro-2H-pyran-5-ylmethyl)prop-2-en-1-amine |
| SMILES | C=C(Cl)CNCC1=CCCOC1 |
| InChI | InChI=1S/C9H14ClNO/c1-8(10)5-11-6-9-3-2-4-12-7-9/h3,11H,1-2,4-7H2 |
| InChIKey | LHEBFLDIVFEVDP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|