C7H11ClN2O — CID 18960954
1,2,3,6-tetrahydropyridin-5-ylmethoxymethanimidoyl chloride (PubChem CID 18960954) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridin-5-ylmethoxymethanimidoyl chloride.
| Compound Name | 1,2,3,6-tetrahydropyridin-5-ylmethoxymethanimidoyl chloride |
|---|---|
| PubChem CID | 18960954 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 1,2,3,6-tetrahydropyridin-5-ylmethoxymethanimidoyl chloride |
| SMILES | [H]/N=C(\Cl)OCC1=CCCNC1 |
| InChI | InChI=1S/C7H11ClN2O/c8-7(9)11-5-6-2-1-3-10-4-6/h2,9-10H,1,3-5H2/b9-7+ |
| InChIKey | UYOIVMATAPUVBA-VQHVLOKHSA-N |
| XLogP | 1.10 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|