C8H13ClN2O — CID 54523476
(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)methoxymethanimidoyl chloride (PubChem CID 54523476) has the molecular formula C8H13ClN2O and a molecular weight of 188.66 g/mol. Its IUPAC name is (6-methyl-1,2,3,6-tetrahydropyridin-5-yl)methoxymethanimidoyl chloride.
| Compound Name | (6-methyl-1,2,3,6-tetrahydropyridin-5-yl)methoxymethanimidoyl chloride |
|---|---|
| PubChem CID | 54523476 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (6-methyl-1,2,3,6-tetrahydropyridin-5-yl)methoxymethanimidoyl chloride |
| SMILES | [H]/N=C(\Cl)OCC1=CCCNC1C |
| InChI | InChI=1S/C8H13ClN2O/c1-6-7(3-2-4-11-6)5-12-8(9)10/h3,6,10-11H,2,4-5H2,1H3/b10-8+ |
| InChIKey | YRMFJKNUPYHKHG-CSKARUKUSA-N |
| XLogP | 1.48 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|