C14H28N2O — CID 114411014
4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-propan-2-ylbutan-1-amine (PubChem CID 114411014) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-propan-2-ylbutan-1-amine.
| Compound Name | 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 114411014 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-propan-2-ylbutan-1-amine |
| SMILES | COCC1=CCN(CCCCNC(C)C)CC1 |
| InChI | InChI=1S/C14H28N2O/c1-13(2)15-8-4-5-9-16-10-6-14(7-11-16)12-17-3/h6,13,15H,4-5,7-12H2,1-3H3 |
| InChIKey | GFSZBSFVCPAIKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|