C7H14N2O — CID 163951235
methoxy(1,2,3,6-tetrahydropyridin-4-yl)methanamine (PubChem CID 163951235) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is methoxy(1,2,3,6-tetrahydropyridin-4-yl)methanamine.
| Compound Name | methoxy(1,2,3,6-tetrahydropyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 163951235 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | methoxy(1,2,3,6-tetrahydropyridin-4-yl)methanamine |
| SMILES | COC(N)C1=CCNCC1 |
| InChI | InChI=1S/C7H14N2O/c1-10-7(8)6-2-4-9-5-3-6/h2,7,9H,3-5,8H2,1H3 |
| InChIKey | RZMPIQBBJYFZFR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|