C8H15NO — CID 143591895
6-methoxy-3,3-dimethyl-2,6-dihydro-1H-pyridine (PubChem CID 143591895) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 6-methoxy-3,3-dimethyl-2,6-dihydro-1H-pyridine.
| Compound Name | 6-methoxy-3,3-dimethyl-2,6-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 143591895 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 6-methoxy-3,3-dimethyl-2,6-dihydro-1H-pyridine |
| SMILES | COC1C=CC(C)(C)CN1 |
| InChI | InChI=1S/C8H15NO/c1-8(2)5-4-7(10-3)9-6-8/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | AHRFTAUSJYNWQD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|