C7H13NO2 — CID 160599293
2,6-dimethoxy-1,2,3,6-tetrahydropyridine (PubChem CID 160599293) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2,6-dimethoxy-1,2,3,6-tetrahydropyridine.
| Compound Name | 2,6-dimethoxy-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 160599293 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2,6-dimethoxy-1,2,3,6-tetrahydropyridine |
| SMILES | COC1C=CCC(OC)N1 |
| InChI | InChI=1S/C7H13NO2/c1-9-6-4-3-5-7(8-6)10-2/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | REBDIBNYJKXMCX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|