C6H9NO2 — CID 21051756
2-methoxy-2,5-dihydro-1H-pyridin-6-one (PubChem CID 21051756) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 2-methoxy-2,5-dihydro-1H-pyridin-6-one.
| Compound Name | 2-methoxy-2,5-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 21051756 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 2-methoxy-2,5-dihydro-1H-pyridin-6-one |
| SMILES | COC1C=CCC(=O)N1 |
| InChI | InChI=1S/C6H9NO2/c1-9-6-4-2-3-5(8)7-6/h2,4,6H,3H2,1H3,(H,7,8) |
| InChIKey | VQSQMHBYVZAXKV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|