C6H12N2O — CID 123663821
6-methoxy-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 123663821) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 6-methoxy-1,2,3,6-tetrahydropyridin-3-amine.
| Compound Name | 6-methoxy-1,2,3,6-tetrahydropyridin-3-amine |
|---|---|
| PubChem CID | 123663821 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 6-methoxy-1,2,3,6-tetrahydropyridin-3-amine |
| SMILES | COC1C=CC(N)CN1 |
| InChI | InChI=1S/C6H12N2O/c1-9-6-3-2-5(7)4-8-6/h2-3,5-6,8H,4,7H2,1H3 |
| InChIKey | DJSJTESRHPGVDL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|