About (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine
(2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine (PubChem CID 146223301) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine |
| PubChem CID | 146223301 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine |
| SMILES | C/C=C(/CN)C(C)(NC(C)C)OC |
| InChI | InChI=1S/C10H22N2O/c1-6-9(7-11)10(4,13-5)12-8(2)3/h6,8,12H,7,11H2,1-5H3/b9-6- |
| InChIKey | FTEPGHXWAVLONN-TWGQIWQCSA-N |
| XLogP | 1.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine?
The IUPAC name of (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine (CID 146223301) is (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine.
What is the SMILES notation for (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine?
The canonical SMILES for (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine is C/C=C(/CN)C(C)(NC(C)C)OC.
What is the InChIKey of (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine?
The InChIKey is FTEPGHXWAVLONN-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H22N2O/c1-6-9(7-11)10(4,13-5)12-8(2)3/h6,8,12H,7,11H2,1-5H3/b9-6-.
What are the key properties of (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine?
(2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine has a molecular weight of 186.30 g/mol, XLogP of 1.25, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-3-methoxy-3-N-propan-2-ylbutane-1,3-diamine is sourced from PubChem (CID 146223301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).