C9H23NO3Si — CID 89392385
2,3-dimethyl-4-trimethoxysilylbutan-2-amine (PubChem CID 89392385) has the molecular formula C9H23NO3Si and a molecular weight of 221.37 g/mol. Its IUPAC name is 2,3-dimethyl-4-trimethoxysilylbutan-2-amine.
| Compound Name | 2,3-dimethyl-4-trimethoxysilylbutan-2-amine |
|---|---|
| PubChem CID | 89392385 |
| Molecular Formula | C9H23NO3Si |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2,3-dimethyl-4-trimethoxysilylbutan-2-amine |
| SMILES | CO[Si](CC(C)C(C)(C)N)(OC)OC |
| InChI | InChI=1S/C9H23NO3Si/c1-8(9(2,3)10)7-14(11-4,12-5)13-6/h8H,7,10H2,1-6H3 |
| InChIKey | FLLBBCGMYIEUJL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|