C18H40O5Si2 — CID 155659391
[ditert-butyl(propan-2-yl)silyl] 2-methyl-3-trimethoxysilylpropanoate (PubChem CID 155659391) has the molecular formula C18H40O5Si2 and a molecular weight of 392.69 g/mol. Its IUPAC name is [ditert-butyl(propan-2-yl)silyl] 2-methyl-3-trimethoxysilylpropanoate.
| Compound Name | [ditert-butyl(propan-2-yl)silyl] 2-methyl-3-trimethoxysilylpropanoate |
|---|---|
| PubChem CID | 155659391 |
| Molecular Formula | C18H40O5Si2 |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [ditert-butyl(propan-2-yl)silyl] 2-methyl-3-trimethoxysilylpropanoate |
| SMILES | CO[Si](CC(C)C(=O)O[Si](C(C)C)(C(C)(C)C)C(C)(C)C)(OC)OC |
| InChI | InChI=1S/C18H40O5Si2/c1-14(2)25(17(4,5)6,18(7,8)9)23-16(19)15(3)13-24(20-10,21-11)22-12/h14-15H,13H2,1-12H3 |
| InChIKey | ZCWLTBHNFRYMEY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|