C22H48O5Si2 — CID 155659186
[dibutyl(tert-butyl)silyl] 2-methyl-3-triethoxysilylpropanoate (PubChem CID 155659186) has the molecular formula C22H48O5Si2 and a molecular weight of 448.79 g/mol. Its IUPAC name is [dibutyl(tert-butyl)silyl] 2-methyl-3-triethoxysilylpropanoate.
| Compound Name | [dibutyl(tert-butyl)silyl] 2-methyl-3-triethoxysilylpropanoate |
|---|---|
| PubChem CID | 155659186 |
| Molecular Formula | C22H48O5Si2 |
| Molecular Weight | 448.79 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | [dibutyl(tert-butyl)silyl] 2-methyl-3-triethoxysilylpropanoate |
| SMILES | CCCC[Si](CCCC)(OC(=O)C(C)C[Si](OCC)(OCC)OCC)C(C)(C)C |
| InChI | InChI=1S/C22H48O5Si2/c1-10-15-17-28(18-16-11-2,22(7,8)9)27-21(23)20(6)19-29(24-12-3,25-13-4)26-14-5/h20H,10-19H2,1-9H3 |
| InChIKey | AHDVSGOSRRDGEE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|