C8H21NO5Si — CID 21018728
1,1-dimethoxy-3-trimethoxysilylpropan-1-amine (PubChem CID 21018728) has the molecular formula C8H21NO5Si and a molecular weight of 239.34 g/mol. Its IUPAC name is 1,1-dimethoxy-3-trimethoxysilylpropan-1-amine.
| Compound Name | 1,1-dimethoxy-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 21018728 |
| Molecular Formula | C8H21NO5Si |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1,1-dimethoxy-3-trimethoxysilylpropan-1-amine |
| SMILES | COC(N)(CC[Si](OC)(OC)OC)OC |
| InChI | InChI=1S/C8H21NO5Si/c1-10-8(9,11-2)6-7-15(12-3,13-4)14-5/h6-7,9H2,1-5H3 |
| InChIKey | PSTSTWMTUJHYIJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|