C13H26N2O — CID 114410969
N-ethyl-4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine (PubChem CID 114410969) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-ethyl-4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine.
| Compound Name | N-ethyl-4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine |
|---|---|
| PubChem CID | 114410969 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-ethyl-4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine |
| SMILES | CCNC(C)CCN1CC=C(COC)CC1 |
| InChI | InChI=1S/C13H26N2O/c1-4-14-12(2)5-8-15-9-6-13(7-10-15)11-16-3/h6,12,14H,4-5,7-11H2,1-3H3 |
| InChIKey | WMCSIAQXGMOISA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|