C12H23NO — CID 115742022
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-ethylbutan-1-amine (PubChem CID 115742022) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-ethylbutan-1-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 115742022 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-ethylbutan-1-amine |
| SMILES | CCC(CC)CNCC1=CCCOC1 |
| InChI | InChI=1S/C12H23NO/c1-3-11(4-2)8-13-9-12-6-5-7-14-10-12/h6,11,13H,3-5,7-10H2,1-2H3 |
| InChIKey | LHOMBCUSFIWMAS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|