C14H25NO — CID 115742173
1-cyclohexyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)ethanamine (PubChem CID 115742173) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-cyclohexyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)ethanamine.
| Compound Name | 1-cyclohexyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115742173 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-cyclohexyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)ethanamine |
| SMILES | CC(NCC1=CCCOC1)C1CCCCC1 |
| InChI | InChI=1S/C14H25NO/c1-12(14-7-3-2-4-8-14)15-10-13-6-5-9-16-11-13/h6,12,14-15H,2-5,7-11H2,1H3 |
| InChIKey | GRDUDWYCLFYWKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|