C22H23N3O3 — CID 11574391
3-hydroxy-7-[(E)-2-[4-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-2,3-dihydroisoindol-1-one (PubChem CID 11574391) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-hydroxy-7-[(E)-2-[4-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 3-hydroxy-7-[(E)-2-[4-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 11574391 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-hydroxy-7-[(E)-2-[4-(4-methylpiperazine-1-carbonyl)phenyl]ethenyl]-2,3-dihydroisoindol-1-one |
| SMILES | CN1CCN(C(=O)c2ccc(/C=C/c3cccc4c3C(=O)NC4O)cc2)CC1 |
| InChI | InChI=1S/C22H23N3O3/c1-24-11-13-25(14-12-24)22(28)17-9-6-15(7-10-17)5-8-16-3-2-4-18-19(16)21(27)23-20(18)26/h2-10,20,26H,11-14H2,1H3,(H,23,27)/b8-5+ |
| InChIKey | RKALIQURJFDVKR-VMPITWQZSA-N |
| XLogP | 1.98 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|