C12H24N2OS — CID 115747672
N-(4-ethylsulfanylbutan-2-yl)-4-methylpyrrolidine-3-carboxamide (PubChem CID 115747672) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-4-methylpyrrolidine-3-carboxamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 115747672 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-4-methylpyrrolidine-3-carboxamide |
| SMILES | CCSCCC(C)NC(=O)C1CNCC1C |
| InChI | InChI=1S/C12H24N2OS/c1-4-16-6-5-10(3)14-12(15)11-8-13-7-9(11)2/h9-11,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | BOEJXGNUNFCYES-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|