C9H19N3O — CID 130778578
N-[(2S)-1-aminopropan-2-yl]-4-methylpyrrolidine-3-carboxamide (PubChem CID 130778578) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-4-methylpyrrolidine-3-carboxamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 130778578 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-4-methylpyrrolidine-3-carboxamide |
| SMILES | CC1CNCC1C(=O)N[C@@H](C)CN |
| InChI | InChI=1S/C9H19N3O/c1-6-4-11-5-8(6)9(13)12-7(2)3-10/h6-8,11H,3-5,10H2,1-2H3,(H,12,13)/t6?,7-,8?/m0/s1 |
| InChIKey | ATGJGUSAAUPMCC-WTIBDHCWSA-N |
| XLogP | -0.69 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |