C15H20N2OS — CID 115748527
N-(isoquinolin-4-ylmethyl)-4-methylsulfinylbutan-2-amine (PubChem CID 115748527) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N-(isoquinolin-4-ylmethyl)-4-methylsulfinylbutan-2-amine.
| Compound Name | N-(isoquinolin-4-ylmethyl)-4-methylsulfinylbutan-2-amine |
|---|---|
| PubChem CID | 115748527 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(isoquinolin-4-ylmethyl)-4-methylsulfinylbutan-2-amine |
| SMILES | CC(CCS(C)=O)NCc1cncc2ccccc12 |
| InChI | InChI=1S/C15H20N2OS/c1-12(7-8-19(2)18)17-11-14-10-16-9-13-5-3-4-6-15(13)14/h3-6,9-10,12,17H,7-8,11H2,1-2H3 |
| InChIKey | CREUVKCFGKFWMW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |